About formic acid;S-quinolin-8-yl cyclohexanecarbothioate
formic acid;S-quinolin-8-yl cyclohexanecarbothioate (PubChem CID 70789851) has the molecular formula C17H19NO3S
and a molecular weight of 317.41 g/mol. Its IUPAC name is formic acid;S-quinolin-8-yl cyclohexanecarbothioate.
Molecular Properties
| Compound Name | formic acid;S-quinolin-8-yl cyclohexanecarbothioate |
| PubChem CID | 70789851 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | formic acid;S-quinolin-8-yl cyclohexanecarbothioate |
| SMILES | O=C(Sc1cccc2cccnc12)C1CCCCC1.O=CO |
| InChI | InChI=1S/C16H17NOS.CH2O2/c18-16(13-6-2-1-3-7-13)19-14-10-4-8-12-9-5-11-17-15(12)14;2-1-3/h4-5,8-11,13H,1-3,6-7H2;1H,(H,2,3) |
| InChIKey | GYODUVZGDSZLBI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze formic acid;S-quinolin-8-yl cyclohexanecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;S-quinolin-8-yl cyclohexanecarbothioate?
The IUPAC name of formic acid;S-quinolin-8-yl cyclohexanecarbothioate (CID 70789851) is formic acid;S-quinolin-8-yl cyclohexanecarbothioate.
What is the SMILES notation for formic acid;S-quinolin-8-yl cyclohexanecarbothioate?
The canonical SMILES for formic acid;S-quinolin-8-yl cyclohexanecarbothioate is O=C(Sc1cccc2cccnc12)C1CCCCC1.O=CO.
What is the InChIKey of formic acid;S-quinolin-8-yl cyclohexanecarbothioate?
The InChIKey is GYODUVZGDSZLBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NOS.CH2O2/c18-16(13-6-2-1-3-7-13)19-14-10-4-8-12-9-5-11-17-15(12)14;2-1-3/h4-5,8-11,13H,1-3,6-7H2;1H,(H,2,3).
What are the key properties of formic acid;S-quinolin-8-yl cyclohexanecarbothioate?
formic acid;S-quinolin-8-yl cyclohexanecarbothioate has a molecular weight of 317.41 g/mol, XLogP of 4.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;S-quinolin-8-yl cyclohexanecarbothioate is sourced from PubChem (CID 70789851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).