C13H12LrNSi- — CID 70790256
3,3-dimethyl-9H-benzo[g][1,3]benzazasilol-9-ide;lawrencium (PubChem CID 70790256) has the molecular formula C13H12LrNSi- and a molecular weight of 472.33 g/mol. Its IUPAC name is 3,3-dimethyl-9H-benzo[g][1,3]benzazasilol-9-ide;lawrencium.
| Compound Name | 3,3-dimethyl-9H-benzo[g][1,3]benzazasilol-9-ide;lawrencium |
|---|---|
| PubChem CID | 70790256 |
| Molecular Formula | C13H12LrNSi- |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 3,3-dimethyl-9H-benzo[g][1,3]benzazasilol-9-ide;lawrencium |
| SMILES | C[Si]1(C)C=Nc2c1ccc1ccc[c-]c21.[Lr] |
| InChI | InChI=1S/C13H12NSi.Lr/c1-15(2)9-14-13-11-6-4-3-5-10(11)7-8-12(13)15;/h3-5,7-9H,1-2H3;/q-1; |
| InChIKey | VVCXACGNUNJXKB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|