C27H32N8O — CID 70791793
6-[(5-amino-2-pyridinyl)amino]-8-[4-[2-(4-ethylpiperazin-1-yl)ethyl]anilino]-2H-2,7-naphthyridin-1-one (PubChem CID 70791793) has the molecular formula C27H32N8O and a molecular weight of 484.61 g/mol. Its IUPAC name is 6-[(5-amino-2-pyridinyl)amino]-8-[4-[2-(4-ethylpiperazin-1-yl)ethyl]anilino]-2H-2,7-naphthyridin-1-one.
| Compound Name | 6-[(5-amino-2-pyridinyl)amino]-8-[4-[2-(4-ethylpiperazin-1-yl)ethyl]anilino]-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 70791793 |
| Molecular Formula | C27H32N8O |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 6-[(5-amino-2-pyridinyl)amino]-8-[4-[2-(4-ethylpiperazin-1-yl)ethyl]anilino]-2H-2,7-naphthyridin-1-one |
| SMILES | CCN1CCN(CCc2ccc(Nc3nc(Nc4ccc(N)cn4)cc4cc[nH]c(=O)c34)cc2)CC1 |
| InChI | InChI=1S/C27H32N8O/c1-2-34-13-15-35(16-14-34)12-10-19-3-6-22(7-4-19)31-26-25-20(9-11-29-27(25)36)17-24(33-26)32-23-8-5-21(28)18-30-23/h3-9,11,17-18H,2,10,12-16,28H2,1H3,(H,29,36)(H2,30,31,32,33) |
| InChIKey | UEAXMMJUJOZNCV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_NH_no_alk_A(1)', 'substructure': 'N/A'} |
|---|