C24H26N4O2 — CID 70800442
N-methyl-6-[[1-(naphthalene-2-carbonyl)azepan-4-yl]amino]pyridine-3-carboxamide (PubChem CID 70800442) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-methyl-6-[[1-(naphthalene-2-carbonyl)azepan-4-yl]amino]pyridine-3-carboxamide.
| Compound Name | N-methyl-6-[[1-(naphthalene-2-carbonyl)azepan-4-yl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 70800442 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-methyl-6-[[1-(naphthalene-2-carbonyl)azepan-4-yl]amino]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(NC2CCCN(C(=O)c3ccc4ccccc4c3)CC2)nc1 |
| InChI | InChI=1S/C24H26N4O2/c1-25-23(29)20-10-11-22(26-16-20)27-21-7-4-13-28(14-12-21)24(30)19-9-8-17-5-2-3-6-18(17)15-19/h2-3,5-6,8-11,15-16,21H,4,7,12-14H2,1H3,(H,25,29)(H,26,27) |
| InChIKey | PLCQEHWMORFWEG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |