C21H25ClN6O2S — CID 70802562
N-[(5-chlorothiophen-2-yl)methyl]-4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]piperazine-1-carboxamide (PubChem CID 70802562) has the molecular formula C21H25ClN6O2S and a molecular weight of 460.99 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 70802562 |
| Molecular Formula | C21H25ClN6O2S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]piperazine-1-carboxamide |
| SMILES | CCOc1cc(N2CCN(C(=O)NCc3ccc(Cl)s3)CC2)ccc1-n1cnc(C)n1 |
| InChI | InChI=1S/C21H25ClN6O2S/c1-3-30-19-12-16(4-6-18(19)28-14-24-15(2)25-28)26-8-10-27(11-9-26)21(29)23-13-17-5-7-20(22)31-17/h4-7,12,14H,3,8-11,13H2,1-2H3,(H,23,29) |
| InChIKey | DNDHYJWPQWCGMY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|