C24H28Cl2N6O3 — CID 88982836
N-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-2-[4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-7-oxo-1,4-diazepan-1-yl]acetamide (PubChem CID 88982836) has the molecular formula C24H28Cl2N6O3 and a molecular weight of 519.43 g/mol. Its IUPAC name is N-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-2-[4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-7-oxo-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-2-[4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-7-oxo-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 88982836 |
| Molecular Formula | C24H28Cl2N6O3 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | N-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-2-[4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-7-oxo-1,4-diazepan-1-yl]acetamide |
| SMILES | CCOc1cc(N2CCC(=O)N(CC(=O)NC3=CC(Cl)C(Cl)C=C3)CC2)ccc1-n1cnc(C)n1 |
| InChI | InChI=1S/C24H28Cl2N6O3/c1-3-35-22-13-18(5-7-21(22)32-15-27-16(2)29-32)30-9-8-24(34)31(11-10-30)14-23(33)28-17-4-6-19(25)20(26)12-17/h4-7,12-13,15,19-20H,3,8-11,14H2,1-2H3,(H,28,33) |
| InChIKey | OGJWQIARJFMYAX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|