C25H31N7O3 — CID 70802594
N-[(3-acetamidophenyl)methyl]-4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]piperazine-1-carboxamide (PubChem CID 70802594) has the molecular formula C25H31N7O3 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-[(3-acetamidophenyl)methyl]-4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-[(3-acetamidophenyl)methyl]-4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 70802594 |
| Molecular Formula | C25H31N7O3 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | N-[(3-acetamidophenyl)methyl]-4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]piperazine-1-carboxamide |
| SMILES | CCOc1cc(N2CCN(C(=O)NCc3cccc(NC(C)=O)c3)CC2)ccc1-n1cnc(C)n1 |
| InChI | InChI=1S/C25H31N7O3/c1-4-35-24-15-22(8-9-23(24)32-17-27-18(2)29-32)30-10-12-31(13-11-30)25(34)26-16-20-6-5-7-21(14-20)28-19(3)33/h5-9,14-15,17H,4,10-13,16H2,1-3H3,(H,26,34)(H,28,33) |
| InChIKey | GWVKNMZBYZOVSE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|