C24H30N6O3 — CID 70802869
4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-N-[(3-methoxyphenyl)methyl]piperazine-1-carboxamide (PubChem CID 70802869) has the molecular formula C24H30N6O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is 4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-N-[(3-methoxyphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-N-[(3-methoxyphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 70802869 |
| Molecular Formula | C24H30N6O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 4-[3-ethoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-N-[(3-methoxyphenyl)methyl]piperazine-1-carboxamide |
| SMILES | CCOc1cc(N2CCN(C(=O)NCc3cccc(OC)c3)CC2)ccc1-n1cnc(C)n1 |
| InChI | InChI=1S/C24H30N6O3/c1-4-33-23-15-20(8-9-22(23)30-17-26-18(2)27-30)28-10-12-29(13-11-28)24(31)25-16-19-6-5-7-21(14-19)32-3/h5-9,14-15,17H,4,10-13,16H2,1-3H3,(H,25,31) |
| InChIKey | VMFCPLBGSXSRQE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|