C13H14F2N2O2 — CID 70806901
4-[4-(difluoromethoxy)-3-hydroxyphenyl]piperidine-4-carbonitrile (PubChem CID 70806901) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)-3-hydroxyphenyl]piperidine-4-carbonitrile.
| Compound Name | 4-[4-(difluoromethoxy)-3-hydroxyphenyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 70806901 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-[4-(difluoromethoxy)-3-hydroxyphenyl]piperidine-4-carbonitrile |
| SMILES | N#CC1(c2ccc(OC(F)F)c(O)c2)CCNCC1 |
| InChI | InChI=1S/C13H14F2N2O2/c14-12(15)19-11-2-1-9(7-10(11)18)13(8-16)3-5-17-6-4-13/h1-2,7,12,17-18H,3-6H2 |
| InChIKey | UOMIGYRBQGZDHQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |