C16H19FO — CID 70807978
1-(3,3-dimethylbutoxy)-7-fluoronaphthalene (PubChem CID 70807978) has the molecular formula C16H19FO and a molecular weight of 246.33 g/mol. Its IUPAC name is 1-(3,3-dimethylbutoxy)-7-fluoronaphthalene.
| Compound Name | 1-(3,3-dimethylbutoxy)-7-fluoronaphthalene |
|---|---|
| PubChem CID | 70807978 |
| Molecular Formula | C16H19FO |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-(3,3-dimethylbutoxy)-7-fluoronaphthalene |
| SMILES | CC(C)(C)CCOc1cccc2ccc(F)cc12 |
| InChI | InChI=1S/C16H19FO/c1-16(2,3)9-10-18-15-6-4-5-12-7-8-13(17)11-14(12)15/h4-8,11H,9-10H2,1-3H3 |
| InChIKey | TXYZODYOXCTTFS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |