C29H30IN3O5S2 — CID 70812778
benzyl 4-iodo-4-[[3-(3-methoxyphenyl)-2,6-dimethylthieno[2,3-b]pyridin-4-yl]sulfamoyl]piperidine-1-carboxylate (PubChem CID 70812778) has the molecular formula C29H30IN3O5S2 and a molecular weight of 691.61 g/mol. Its IUPAC name is benzyl 4-iodo-4-[[3-(3-methoxyphenyl)-2,6-dimethylthieno[2,3-b]pyridin-4-yl]sulfamoyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-iodo-4-[[3-(3-methoxyphenyl)-2,6-dimethylthieno[2,3-b]pyridin-4-yl]sulfamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70812778 |
| Molecular Formula | C29H30IN3O5S2 |
| Molecular Weight | 691.61 g/mol |
| Exact Mass | 691.07 |
| IUPAC Name | benzyl 4-iodo-4-[[3-(3-methoxyphenyl)-2,6-dimethylthieno[2,3-b]pyridin-4-yl]sulfamoyl]piperidine-1-carboxylate |
| SMILES | COc1cccc(-c2c(C)sc3nc(C)cc(NS(=O)(=O)C4(I)CCN(C(=O)OCc5ccccc5)CC4)c23)c1 |
| InChI | InChI=1S/C29H30IN3O5S2/c1-19-16-24(26-25(20(2)39-27(26)31-19)22-10-7-11-23(17-22)37-3)32-40(35,36)29(30)12-14-33(15-13-29)28(34)38-18-21-8-5-4-6-9-21/h4-11,16-17H,12-15,18H2,1-3H3,(H,31,32) |
| InChIKey | BDJAALBNXFPDDV-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.61 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|