C29H34F2N4O8 — CID 70815335
tert-butyl 4-[(1R)-1-[[(6S)-6-[(4,5-difluoro-2-methoxyphenyl)methyl]-3,7-dioxo-1,4-diazepane-1-carbonyl]amino]butyl]-2-nitrobenzoate (PubChem CID 70815335) has the molecular formula C29H34F2N4O8 and a molecular weight of 604.61 g/mol. Its IUPAC name is tert-butyl 4-[(1R)-1-[[(6S)-6-[(4,5-difluoro-2-methoxyphenyl)methyl]-3,7-dioxo-1,4-diazepane-1-carbonyl]amino]butyl]-2-nitrobenzoate.
| Compound Name | tert-butyl 4-[(1R)-1-[[(6S)-6-[(4,5-difluoro-2-methoxyphenyl)methyl]-3,7-dioxo-1,4-diazepane-1-carbonyl]amino]butyl]-2-nitrobenzoate |
|---|---|
| PubChem CID | 70815335 |
| Molecular Formula | C29H34F2N4O8 |
| Molecular Weight | 604.61 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | tert-butyl 4-[(1R)-1-[[(6S)-6-[(4,5-difluoro-2-methoxyphenyl)methyl]-3,7-dioxo-1,4-diazepane-1-carbonyl]amino]butyl]-2-nitrobenzoate |
| SMILES | CCC[C@@H](NC(=O)N1CC(=O)NC[C@H](Cc2cc(F)c(F)cc2OC)C1=O)c1ccc(C(=O)OC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H34F2N4O8/c1-6-7-22(16-8-9-19(23(12-16)35(40)41)27(38)43-29(2,3)4)33-28(39)34-15-25(36)32-14-18(26(34)37)10-17-11-20(30)21(31)13-24(17)42-5/h8-9,11-13,18,22H,6-7,10,14-15H2,1-5H3,(H,32,36)(H,33,39)/t18-,22+/m0/s1 |
| InChIKey | WVCAKFUNUTXAPR-PGRDOPGGSA-N |
| XLogP | 4.20 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|