C34H37ClN4O11 — CID 123818197
4-[(1R)-1-[[(6S)-6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-4-[(2,4,6-trimethoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]amino]propyl]-2-nitrobenzoic acid (PubChem CID 123818197) has the molecular formula C34H37ClN4O11 and a molecular weight of 713.14 g/mol. Its IUPAC name is 4-[(1R)-1-[[(6S)-6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-4-[(2,4,6-trimethoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]amino]propyl]-2-nitrobenzoic acid.
| Compound Name | 4-[(1R)-1-[[(6S)-6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-4-[(2,4,6-trimethoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]amino]propyl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 123818197 |
| Molecular Formula | C34H37ClN4O11 |
| Molecular Weight | 713.14 g/mol |
| Exact Mass | 712.21 |
| IUPAC Name | 4-[(1R)-1-[[(6S)-6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-4-[(2,4,6-trimethoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]amino]propyl]-2-nitrobenzoic acid |
| SMILES | CC[C@@H](NC(=O)N1CC(=O)N(Cc2c(OC)cc(OC)cc2OC)C[C@H](Cc2cc(Cl)ccc2OC)C1=O)c1ccc(C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H37ClN4O11/c1-6-26(19-7-9-24(33(42)43)27(13-19)39(45)46)36-34(44)38-18-31(40)37(17-25-29(49-4)14-23(47-2)15-30(25)50-5)16-21(32(38)41)11-20-12-22(35)8-10-28(20)48-3/h7-10,12-15,21,26H,6,11,16-18H2,1-5H3,(H,36,44)(H,42,43)/t21-,26+/m0/s1 |
| InChIKey | HOLZYYZCAXDEEA-HFZDXXHNSA-N |
| XLogP | 4.87 |
| TPSA | 187.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.14 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|