C28H36ClN5O6 — CID 88994563
2-amino-4-[(1R)-1-[[(6S)-6-[(5-chloro-2-methoxyphenyl)methyl]-3-ethoxyimino-4-methyl-7-oxo-1,4-diazepane-1-carbonyl]amino]butyl]benzoic acid (PubChem CID 88994563) has the molecular formula C28H36ClN5O6 and a molecular weight of 574.08 g/mol. Its IUPAC name is 2-amino-4-[(1R)-1-[[(6S)-6-[(5-chloro-2-methoxyphenyl)methyl]-3-ethoxyimino-4-methyl-7-oxo-1,4-diazepane-1-carbonyl]amino]butyl]benzoic acid.
| Compound Name | 2-amino-4-[(1R)-1-[[(6S)-6-[(5-chloro-2-methoxyphenyl)methyl]-3-ethoxyimino-4-methyl-7-oxo-1,4-diazepane-1-carbonyl]amino]butyl]benzoic acid |
|---|---|
| PubChem CID | 88994563 |
| Molecular Formula | C28H36ClN5O6 |
| Molecular Weight | 574.08 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | 2-amino-4-[(1R)-1-[[(6S)-6-[(5-chloro-2-methoxyphenyl)methyl]-3-ethoxyimino-4-methyl-7-oxo-1,4-diazepane-1-carbonyl]amino]butyl]benzoic acid |
| SMILES | CCC[C@@H](NC(=O)N1CC(=NOCC)N(C)C[C@H](Cc2cc(Cl)ccc2OC)C1=O)c1ccc(C(=O)O)c(N)c1 |
| InChI | InChI=1S/C28H36ClN5O6/c1-5-7-23(17-8-10-21(27(36)37)22(30)14-17)31-28(38)34-16-25(32-40-6-2)33(3)15-19(26(34)35)12-18-13-20(29)9-11-24(18)39-4/h8-11,13-14,19,23H,5-7,12,15-16,30H2,1-4H3,(H,31,38)(H,36,37)/t19-,23+/m0/s1 |
| InChIKey | IWGQQFUMVQBHEL-WMZHIEFXSA-N |
| XLogP | 4.16 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.08 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|