C38H47ClN4O9 — CID 66934849
tert-butyl 2-amino-4-[(1R)-1-[[(6S)-6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-4-[(2,4,6-trimethoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]amino]propyl]benzoate (PubChem CID 66934849) has the molecular formula C38H47ClN4O9 and a molecular weight of 739.27 g/mol. Its IUPAC name is tert-butyl 2-amino-4-[(1R)-1-[[(6S)-6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-4-[(2,4,6-trimethoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]amino]propyl]benzoate.
| Compound Name | tert-butyl 2-amino-4-[(1R)-1-[[(6S)-6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-4-[(2,4,6-trimethoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]amino]propyl]benzoate |
|---|---|
| PubChem CID | 66934849 |
| Molecular Formula | C38H47ClN4O9 |
| Molecular Weight | 739.27 g/mol |
| Exact Mass | 738.30 |
| IUPAC Name | tert-butyl 2-amino-4-[(1R)-1-[[(6S)-6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-4-[(2,4,6-trimethoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]amino]propyl]benzoate |
| SMILES | CC[C@@H](NC(=O)N1CC(=O)N(Cc2c(OC)cc(OC)cc2OC)C[C@H](Cc2cc(Cl)ccc2OC)C1=O)c1ccc(C(=O)OC(C)(C)C)c(N)c1 |
| InChI | InChI=1S/C38H47ClN4O9/c1-9-30(22-10-12-27(29(40)16-22)36(46)52-38(2,3)4)41-37(47)43-21-34(44)42(20-28-32(50-7)17-26(48-5)18-33(28)51-8)19-24(35(43)45)14-23-15-25(39)11-13-31(23)49-6/h10-13,15-18,24,30H,9,14,19-21,40H2,1-8H3,(H,41,47)/t24-,30+/m0/s1 |
| InChIKey | CRNQCXXMMAJSFS-QABMSTFYSA-N |
| XLogP | 5.80 |
| TPSA | 158.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.27 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|