C17H23BN2O5 — CID 70825325
methyl 2-[1-(aminomethoxy)borinan-4-ylidene]-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 70825325) has the molecular formula C17H23BN2O5 and a molecular weight of 346.19 g/mol. Its IUPAC name is methyl 2-[1-(aminomethoxy)borinan-4-ylidene]-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | methyl 2-[1-(aminomethoxy)borinan-4-ylidene]-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 70825325 |
| Molecular Formula | C17H23BN2O5 |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | methyl 2-[1-(aminomethoxy)borinan-4-ylidene]-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | COC(=O)C(NC(=O)OCc1ccccc1)=C1CCB(OCN)CC1 |
| InChI | InChI=1S/C17H23BN2O5/c1-23-16(21)15(14-7-9-18(10-8-14)25-12-19)20-17(22)24-11-13-5-3-2-4-6-13/h2-6H,7-12,19H2,1H3,(H,20,22) |
| InChIKey | FDPZKEYZOZSYPF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|