C19H25NO6 — CID 90895680
methyl 2-(1,4-dioxecan-7-ylidene)-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 90895680) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is methyl 2-(1,4-dioxecan-7-ylidene)-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | methyl 2-(1,4-dioxecan-7-ylidene)-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 90895680 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | methyl 2-(1,4-dioxecan-7-ylidene)-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | COC(=O)C(NC(=O)OCc1ccccc1)=C1CCCOCCOCC1 |
| InChI | InChI=1S/C19H25NO6/c1-23-18(21)17(16-8-5-10-24-12-13-25-11-9-16)20-19(22)26-14-15-6-3-2-4-7-15/h2-4,6-7H,5,8-14H2,1H3,(H,20,22) |
| InChIKey | XAPDKDGNJKUDNA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|