C24H40N4O8S2 — CID 70826387
2,6-bis[[2-(3-morpholin-4-yl-3-oxopropyl)sulfanylacetyl]amino]hexanoic acid (PubChem CID 70826387) has the molecular formula C24H40N4O8S2 and a molecular weight of 576.74 g/mol. Its IUPAC name is 2,6-bis[[2-(3-morpholin-4-yl-3-oxopropyl)sulfanylacetyl]amino]hexanoic acid.
| Compound Name | 2,6-bis[[2-(3-morpholin-4-yl-3-oxopropyl)sulfanylacetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 70826387 |
| Molecular Formula | C24H40N4O8S2 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 2,6-bis[[2-(3-morpholin-4-yl-3-oxopropyl)sulfanylacetyl]amino]hexanoic acid |
| SMILES | O=C(CSCCC(=O)N1CCOCC1)NCCCCC(NC(=O)CSCCC(=O)N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C24H40N4O8S2/c29-20(17-37-15-4-22(31)27-7-11-35-12-8-27)25-6-2-1-3-19(24(33)34)26-21(30)18-38-16-5-23(32)28-9-13-36-14-10-28/h19H,1-18H2,(H,25,29)(H,26,30)(H,33,34) |
| InChIKey | KJWGTHAMSUGUQC-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|