C23H24N2S — CID 70831286
6-[5-(4-butan-2-ylphenyl)thiophen-2-yl]-2-ethyl-1H-benzimidazole (PubChem CID 70831286) has the molecular formula C23H24N2S and a molecular weight of 360.53 g/mol. Its IUPAC name is 6-[5-(4-butan-2-ylphenyl)thiophen-2-yl]-2-ethyl-1H-benzimidazole.
| Compound Name | 6-[5-(4-butan-2-ylphenyl)thiophen-2-yl]-2-ethyl-1H-benzimidazole |
|---|---|
| PubChem CID | 70831286 |
| Molecular Formula | C23H24N2S |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 6-[5-(4-butan-2-ylphenyl)thiophen-2-yl]-2-ethyl-1H-benzimidazole |
| SMILES | CCc1nc2ccc(-c3ccc(-c4ccc(C(C)CC)cc4)s3)cc2[nH]1 |
| InChI | InChI=1S/C23H24N2S/c1-4-15(3)16-6-8-17(9-7-16)21-12-13-22(26-21)18-10-11-19-20(14-18)25-23(5-2)24-19/h6-15H,4-5H2,1-3H3,(H,24,25) |
| InChIKey | WOCWACXUBPRBAK-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |