C30H33N4O3+ — CID 7083433
(5R)-2,2-dimethyl-5-[4-(4-methylpiperazin-4-ium-1-yl)-3-nitrophenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one (PubChem CID 7083433) has the molecular formula C30H33N4O3+ and a molecular weight of 497.62 g/mol. Its IUPAC name is (5R)-2,2-dimethyl-5-[4-(4-methylpiperazin-4-ium-1-yl)-3-nitrophenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one.
| Compound Name | (5R)-2,2-dimethyl-5-[4-(4-methylpiperazin-4-ium-1-yl)-3-nitrophenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
|---|---|
| PubChem CID | 7083433 |
| Molecular Formula | C30H33N4O3+ |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | (5R)-2,2-dimethyl-5-[4-(4-methylpiperazin-4-ium-1-yl)-3-nitrophenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
| SMILES | C[NH+]1CCN(c2ccc([C@H]3Nc4ccc5ccccc5c4C4=C3C(=O)CC(C)(C)C4)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C30H32N4O3/c1-30(2)17-22-27-21-7-5-4-6-19(21)8-10-23(27)31-29(28(22)26(35)18-30)20-9-11-24(25(16-20)34(36)37)33-14-12-32(3)13-15-33/h4-11,16,29,31H,12-15,17-18H2,1-3H3/p+1/t29-/m1/s1 |
| InChIKey | OZPHOUWOQGNFCA-GDLZYMKVSA-O |
| XLogP | 4.39 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|