C10H21NO3 — CID 70840318
3-amino-5-ethyl-2-(methoxymethyl)-6-methyloxan-4-ol (PubChem CID 70840318) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 3-amino-5-ethyl-2-(methoxymethyl)-6-methyloxan-4-ol.
| Compound Name | 3-amino-5-ethyl-2-(methoxymethyl)-6-methyloxan-4-ol |
|---|---|
| PubChem CID | 70840318 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 3-amino-5-ethyl-2-(methoxymethyl)-6-methyloxan-4-ol |
| SMILES | CCC1C(C)OC(COC)C(N)C1O |
| InChI | InChI=1S/C10H21NO3/c1-4-7-6(2)14-8(5-13-3)9(11)10(7)12/h6-10,12H,4-5,11H2,1-3H3 |
| InChIKey | APFXHLKQVPLHDS-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |