C27H30N2O5S — CID 70840643
4-[4-[2-[(4-phenyl-2,3-dihydrothiophene-2-carbonyl)amino]ethylcarbamoyl]phenoxy]cyclohexane-1-carboxylic acid (PubChem CID 70840643) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is 4-[4-[2-[(4-phenyl-2,3-dihydrothiophene-2-carbonyl)amino]ethylcarbamoyl]phenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[2-[(4-phenyl-2,3-dihydrothiophene-2-carbonyl)amino]ethylcarbamoyl]phenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 70840643 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 4-[4-[2-[(4-phenyl-2,3-dihydrothiophene-2-carbonyl)amino]ethylcarbamoyl]phenoxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NCCNC(=O)C1CC(c2ccccc2)=CS1)c1ccc(OC2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C27H30N2O5S/c30-25(19-6-10-22(11-7-19)34-23-12-8-20(9-13-23)27(32)33)28-14-15-29-26(31)24-16-21(17-35-24)18-4-2-1-3-5-18/h1-7,10-11,17,20,23-24H,8-9,12-16H2,(H,28,30)(H,29,31)(H,32,33) |
| InChIKey | FGFVXADCISCPEL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|