C32H55BrO2 — CID 70849628
8-bromo-6-butoxy-2,5,7-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromene (PubChem CID 70849628) has the molecular formula C32H55BrO2 and a molecular weight of 551.69 g/mol. Its IUPAC name is 8-bromo-6-butoxy-2,5,7-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromene.
| Compound Name | 8-bromo-6-butoxy-2,5,7-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromene |
|---|---|
| PubChem CID | 70849628 |
| Molecular Formula | C32H55BrO2 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 550.34 |
| IUPAC Name | 8-bromo-6-butoxy-2,5,7-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromene |
| SMILES | CCCCOc1c(C)c(Br)c2c(c1C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C32H55BrO2/c1-9-10-22-34-30-26(6)28-19-21-32(8,35-31(28)29(33)27(30)7)20-13-18-25(5)17-12-16-24(4)15-11-14-23(2)3/h23-25H,9-22H2,1-8H3 |
| InChIKey | BJVWMWXIAKRDAE-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|