C30H31ClN2O7 — CID 70849986
2-[3-[2-[[(3R,4R)-3-(4-chlorophenyl)-2-[(2S,3S)-1,3-dihydroxybutan-2-yl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]phenoxy]acetic acid (PubChem CID 70849986) has the molecular formula C30H31ClN2O7 and a molecular weight of 567.04 g/mol. Its IUPAC name is 2-[3-[2-[[(3R,4R)-3-(4-chlorophenyl)-2-[(2S,3S)-1,3-dihydroxybutan-2-yl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[2-[[(3R,4R)-3-(4-chlorophenyl)-2-[(2S,3S)-1,3-dihydroxybutan-2-yl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 70849986 |
| Molecular Formula | C30H31ClN2O7 |
| Molecular Weight | 567.04 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 2-[3-[2-[[(3R,4R)-3-(4-chlorophenyl)-2-[(2S,3S)-1,3-dihydroxybutan-2-yl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]phenoxy]acetic acid |
| SMILES | C[C@H](O)[C@H](CO)N1C(=O)c2ccccc2[C@@H](C(=O)NCCc2cccc(OCC(=O)O)c2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H31ClN2O7/c1-18(35)25(16-34)33-28(20-9-11-21(31)12-10-20)27(23-7-2-3-8-24(23)30(33)39)29(38)32-14-13-19-5-4-6-22(15-19)40-17-26(36)37/h2-12,15,18,25,27-28,34-35H,13-14,16-17H2,1H3,(H,32,38)(H,36,37)/t18-,25-,27+,28-/m0/s1 |
| InChIKey | CVYSXXQYMQHTMB-IGSLIWSASA-N |
| XLogP | 3.18 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.04 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |