C37H38Cl2N2O7 — CID 137389949
benzyl 2-[3-[2-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(2S,3S)-1,3-dihydroxybutan-2-yl]-1-oxo-3,4-dihydroisoquinolin-4-yl]-hydroxymethyl]amino]ethyl]phenoxy]acetate (PubChem CID 137389949) has the molecular formula C37H38Cl2N2O7 and a molecular weight of 693.62 g/mol. Its IUPAC name is benzyl 2-[3-[2-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(2S,3S)-1,3-dihydroxybutan-2-yl]-1-oxo-3,4-dihydroisoquinolin-4-yl]-hydroxymethyl]amino]ethyl]phenoxy]acetate.
| Compound Name | benzyl 2-[3-[2-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(2S,3S)-1,3-dihydroxybutan-2-yl]-1-oxo-3,4-dihydroisoquinolin-4-yl]-hydroxymethyl]amino]ethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 137389949 |
| Molecular Formula | C37H38Cl2N2O7 |
| Molecular Weight | 693.62 g/mol |
| Exact Mass | 692.21 |
| IUPAC Name | benzyl 2-[3-[2-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(2S,3S)-1,3-dihydroxybutan-2-yl]-1-oxo-3,4-dihydroisoquinolin-4-yl]-hydroxymethyl]amino]ethyl]phenoxy]acetate |
| SMILES | C[C@H](O)[C@H](CO)N1C(=O)c2ccccc2[C@@H](C(O)NCCc2cccc(OCC(=O)OCc3ccccc3)c2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C37H38Cl2N2O7/c1-23(43)32(20-42)41-35(30-15-14-26(38)19-31(30)39)34(28-12-5-6-13-29(28)37(41)46)36(45)40-17-16-24-10-7-11-27(18-24)47-22-33(44)48-21-25-8-3-2-4-9-25/h2-15,18-19,23,32,34-36,40,42-43,45H,16-17,20-22H2,1H3/t23-,32-,34+,35-,36?/m0/s1 |
| InChIKey | OIJQLUNTLKFQJT-NWSWUHLJSA-N |
| XLogP | 5.29 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|