C31H27Cl2N3O5 — CID 59478702
(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59478702) has the molecular formula C31H27Cl2N3O5 and a molecular weight of 592.48 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59478702 |
| Molecular Formula | C31H27Cl2N3O5 |
| Molecular Weight | 592.48 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | O=C(NOCc1ccccn1)[C@@H]1c2ccccc2C(=O)N([C@@H](CO)[C@@H](O)c2ccccc2)[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H27Cl2N3O5/c32-20-13-14-24(25(33)16-20)28-27(30(39)35-41-18-21-10-6-7-15-34-21)22-11-4-5-12-23(22)31(40)36(28)26(17-37)29(38)19-8-2-1-3-9-19/h1-16,26-29,37-38H,17-18H2,(H,35,39)/t26-,27+,28-,29-/m0/s1 |
| InChIKey | FWSRRTCUMKMNOJ-CRNKYVSFSA-N |
| XLogP | 5.01 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|