C28H28Cl2N4O5S — CID 137389820
2-[[3-(2,4-dichlorophenyl)-1-oxo-4-(pyridin-2-ylmethoxycarbamoyl)-3,4-dihydroisoquinolin-2-yl]methyl]piperidine-1-sulfinic acid (PubChem CID 137389820) has the molecular formula C28H28Cl2N4O5S and a molecular weight of 603.53 g/mol. Its IUPAC name is 2-[[3-(2,4-dichlorophenyl)-1-oxo-4-(pyridin-2-ylmethoxycarbamoyl)-3,4-dihydroisoquinolin-2-yl]methyl]piperidine-1-sulfinic acid.
| Compound Name | 2-[[3-(2,4-dichlorophenyl)-1-oxo-4-(pyridin-2-ylmethoxycarbamoyl)-3,4-dihydroisoquinolin-2-yl]methyl]piperidine-1-sulfinic acid |
|---|---|
| PubChem CID | 137389820 |
| Molecular Formula | C28H28Cl2N4O5S |
| Molecular Weight | 603.53 g/mol |
| Exact Mass | 602.12 |
| IUPAC Name | 2-[[3-(2,4-dichlorophenyl)-1-oxo-4-(pyridin-2-ylmethoxycarbamoyl)-3,4-dihydroisoquinolin-2-yl]methyl]piperidine-1-sulfinic acid |
| SMILES | O=C(NOCc1ccccn1)C1c2ccccc2C(=O)N(CC2CCCCN2S(=O)O)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H28Cl2N4O5S/c29-18-11-12-23(24(30)15-18)26-25(27(35)32-39-17-19-7-3-5-13-31-19)21-9-1-2-10-22(21)28(36)33(26)16-20-8-4-6-14-34(20)40(37)38/h1-3,5,7,9-13,15,20,25-26H,4,6,8,14,16-17H2,(H,32,35)(H,37,38) |
| InChIKey | JXCJULUEWORWOO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|