C30H31Cl2N3O5S — CID 59478662
3-(2,4-dichlorophenyl)-2-[(1-methylsulfonylpiperidin-2-yl)methyl]-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59478662) has the molecular formula C30H31Cl2N3O5S and a molecular weight of 616.57 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-2-[(1-methylsulfonylpiperidin-2-yl)methyl]-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | 3-(2,4-dichlorophenyl)-2-[(1-methylsulfonylpiperidin-2-yl)methyl]-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59478662 |
| Molecular Formula | C30H31Cl2N3O5S |
| Molecular Weight | 616.57 g/mol |
| Exact Mass | 615.14 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-2-[(1-methylsulfonylpiperidin-2-yl)methyl]-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCCCC1CN1C(=O)c2ccccc2C(C(=O)NOCc2ccccc2)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H31Cl2N3O5S/c1-41(38,39)35-16-8-7-11-22(35)18-34-28(25-15-14-21(31)17-26(25)32)27(23-12-5-6-13-24(23)30(34)37)29(36)33-40-19-20-9-3-2-4-10-20/h2-6,9-10,12-15,17,22,27-28H,7-8,11,16,18-19H2,1H3,(H,33,36) |
| InChIKey | PLSYVFJFKLLTAE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|