C13H17P — CID 70861155
cyclohex-2-en-1-yl-(4-methylphenyl)phosphane (PubChem CID 70861155) has the molecular formula C13H17P and a molecular weight of 204.25 g/mol. Its IUPAC name is cyclohex-2-en-1-yl-(4-methylphenyl)phosphane.
| Compound Name | cyclohex-2-en-1-yl-(4-methylphenyl)phosphane |
|---|---|
| PubChem CID | 70861155 |
| Molecular Formula | C13H17P |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | cyclohex-2-en-1-yl-(4-methylphenyl)phosphane |
| SMILES | Cc1ccc(PC2C=CCCC2)cc1 |
| InChI | InChI=1S/C13H17P/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12/h3,5,7-10,12,14H,2,4,6H2,1H3 |
| InChIKey | VXYKHRMBYBSDJI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|