C23H21N2O5+ — CID 7086484
(1S,11S,12R,16S)-11-(2,5-dimethoxybenzoyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 7086484) has the molecular formula C23H21N2O5+ and a molecular weight of 405.43 g/mol. Its IUPAC name is (1S,11S,12R,16S)-11-(2,5-dimethoxybenzoyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11S,12R,16S)-11-(2,5-dimethoxybenzoyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 7086484 |
| Molecular Formula | C23H21N2O5+ |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (1S,11S,12R,16S)-11-(2,5-dimethoxybenzoyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | COc1ccc(OC)c(C(=O)[C@@H]2[C@@H]3C(=O)NC(=O)[C@@H]3[C@H]3c4ccccc4C=C[NH+]23)c1 |
| InChI | InChI=1S/C23H20N2O5/c1-29-13-7-8-16(30-2)15(11-13)21(26)20-18-17(22(27)24-23(18)28)19-14-6-4-3-5-12(14)9-10-25(19)20/h3-11,17-20H,1-2H3,(H,24,27,28)/p+1/t17-,18+,19+,20-/m0/s1 |
| InChIKey | DYBOMRGHBDPBGX-NMLBUPMWSA-O |
| XLogP | 0.77 |
| TPSA | 86.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|