C21H16N3O5+ — CID 7008666
(1S,11S,12R,16S)-11-(3-nitrobenzoyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 7008666) has the molecular formula C21H16N3O5+ and a molecular weight of 390.38 g/mol. Its IUPAC name is (1S,11S,12R,16S)-11-(3-nitrobenzoyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11S,12R,16S)-11-(3-nitrobenzoyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 7008666 |
| Molecular Formula | C21H16N3O5+ |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (1S,11S,12R,16S)-11-(3-nitrobenzoyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C1NC(=O)[C@H]2[C@@H]1[C@@H](C(=O)c1cccc([N+](=O)[O-])c1)[NH+]1C=Cc3ccccc3[C@H]21 |
| InChI | InChI=1S/C21H15N3O5/c25-19(12-5-3-6-13(10-12)24(28)29)18-16-15(20(26)22-21(16)27)17-14-7-2-1-4-11(14)8-9-23(17)18/h1-10,15-18H,(H,22,26,27)/p+1/t15-,16+,17+,18-/m0/s1 |
| InChIKey | RXNOHIQAEWJFEK-MLHJIOFPSA-O |
| XLogP | 0.66 |
| TPSA | 110.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|