C24H23N2O5+ — CID 7086905
(1R,11S,12R,16S)-11-acetyl-14-(2,5-dimethoxyphenyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 7086905) has the molecular formula C24H23N2O5+ and a molecular weight of 419.46 g/mol. Its IUPAC name is (1R,11S,12R,16S)-11-acetyl-14-(2,5-dimethoxyphenyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1R,11S,12R,16S)-11-acetyl-14-(2,5-dimethoxyphenyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 7086905 |
| Molecular Formula | C24H23N2O5+ |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (1R,11S,12R,16S)-11-acetyl-14-(2,5-dimethoxyphenyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | COc1ccc(OC)c(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2c4ccccc4C=C[NH+]2[C@@H]3C(C)=O)c1 |
| InChI | InChI=1S/C24H22N2O5/c1-13(27)21-19-20(22-16-7-5-4-6-14(16)10-11-25(21)22)24(29)26(23(19)28)17-12-15(30-2)8-9-18(17)31-3/h4-12,19-22H,1-3H3/p+1/t19-,20+,21-,22+/m1/s1 |
| InChIKey | MYAGCLQIUTYAEN-MBDNFAEBSA-O |
| XLogP | 1.39 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|