C22H18N3O3+ — CID 2027112
(1R,11R,12S,16R)-14-(4-methoxyphenyl)-13,15-dioxo-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile (PubChem CID 2027112) has the molecular formula C22H18N3O3+ and a molecular weight of 372.40 g/mol. Its IUPAC name is (1R,11R,12S,16R)-14-(4-methoxyphenyl)-13,15-dioxo-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile.
| Compound Name | (1R,11R,12S,16R)-14-(4-methoxyphenyl)-13,15-dioxo-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile |
|---|---|
| PubChem CID | 2027112 |
| Molecular Formula | C22H18N3O3+ |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (1R,11R,12S,16R)-14-(4-methoxyphenyl)-13,15-dioxo-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile |
| SMILES | COc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@H](C#N)[NH+]2C=Cc4ccccc4[C@@H]32)cc1 |
| InChI | InChI=1S/C22H17N3O3/c1-28-15-8-6-14(7-9-15)25-21(26)18-17(12-23)24-11-10-13-4-2-3-5-16(13)20(24)19(18)22(25)27/h2-11,17-20H,1H3/p+1/t17-,18+,19+,20-/m0/s1 |
| InChIKey | RKIJASNCZKCRBN-NMLBUPMWSA-O |
| XLogP | 1.32 |
| TPSA | 74.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|