C32H41N3O2 — CID 70867067
1-[4-[5-(1-cyclopropyl-7,7-dimethyl-6,8-dihydro-5H-isoquinolin-4-yl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]-5,5-dimethylhexan-3-one (PubChem CID 70867067) has the molecular formula C32H41N3O2 and a molecular weight of 499.70 g/mol. Its IUPAC name is 1-[4-[5-(1-cyclopropyl-7,7-dimethyl-6,8-dihydro-5H-isoquinolin-4-yl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]-5,5-dimethylhexan-3-one.
| Compound Name | 1-[4-[5-(1-cyclopropyl-7,7-dimethyl-6,8-dihydro-5H-isoquinolin-4-yl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]-5,5-dimethylhexan-3-one |
|---|---|
| PubChem CID | 70867067 |
| Molecular Formula | C32H41N3O2 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | 1-[4-[5-(1-cyclopropyl-7,7-dimethyl-6,8-dihydro-5H-isoquinolin-4-yl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]-5,5-dimethylhexan-3-one |
| SMILES | Cc1cc(-c2noc(-c3cnc(C4CC4)c4c3CCC(C)(C)C4)n2)cc(C)c1CCC(=O)CC(C)(C)C |
| InChI | InChI=1S/C32H41N3O2/c1-19-14-22(15-20(2)24(19)11-10-23(36)16-31(3,4)5)29-34-30(37-35-29)27-18-33-28(21-8-9-21)26-17-32(6,7)13-12-25(26)27/h14-15,18,21H,8-13,16-17H2,1-7H3 |
| InChIKey | ULGLZBAMWKTKQM-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |