C20H34N6O2 — CID 70867288
(2S)-2-amino-6-[bis[(1-propylimidazol-2-yl)methyl]amino]hexanoic acid (PubChem CID 70867288) has the molecular formula C20H34N6O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is (2S)-2-amino-6-[bis[(1-propylimidazol-2-yl)methyl]amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[bis[(1-propylimidazol-2-yl)methyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 70867288 |
| Molecular Formula | C20H34N6O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | (2S)-2-amino-6-[bis[(1-propylimidazol-2-yl)methyl]amino]hexanoic acid |
| SMILES | CCCn1ccnc1CN(CCCC[C@H](N)C(=O)O)Cc1nccn1CCC |
| InChI | InChI=1S/C20H34N6O2/c1-3-10-25-13-8-22-18(25)15-24(12-6-5-7-17(21)20(27)28)16-19-23-9-14-26(19)11-4-2/h8-9,13-14,17H,3-7,10-12,15-16,21H2,1-2H3,(H,27,28)/t17-/m0/s1 |
| InChIKey | OJOUCVXYSUXHGP-KRWDZBQOSA-N |
| XLogP | 2.48 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|