C16H26N6O2 — CID 91137328
(2S)-2-amino-6-[bis[(5-methyl-1H-imidazol-2-yl)methyl]amino]hexanoic acid (PubChem CID 91137328) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (2S)-2-amino-6-[bis[(5-methyl-1H-imidazol-2-yl)methyl]amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[bis[(5-methyl-1H-imidazol-2-yl)methyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 91137328 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (2S)-2-amino-6-[bis[(5-methyl-1H-imidazol-2-yl)methyl]amino]hexanoic acid |
| SMILES | Cc1cnc(CN(CCCC[C@H](N)C(=O)O)Cc2ncc(C)[nH]2)[nH]1 |
| InChI | InChI=1S/C16H26N6O2/c1-11-7-18-14(20-11)9-22(10-15-19-8-12(2)21-15)6-4-3-5-13(17)16(23)24/h7-8,13H,3-6,9-10,17H2,1-2H3,(H,18,20)(H,19,21)(H,23,24)/t13-/m0/s1 |
| InChIKey | ZXLCTWKDVUEJCG-ZDUSSCGKSA-N |
| XLogP | 1.33 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|