C14H22N6O2 — CID 102225246
2-amino-6-[bis(1H-imidazol-2-ylmethyl)amino]hexanoic acid (PubChem CID 102225246) has the molecular formula C14H22N6O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-amino-6-[bis(1H-imidazol-2-ylmethyl)amino]hexanoic acid.
| Compound Name | 2-amino-6-[bis(1H-imidazol-2-ylmethyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 102225246 |
| Molecular Formula | C14H22N6O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-amino-6-[bis(1H-imidazol-2-ylmethyl)amino]hexanoic acid |
| SMILES | NC(CCCCN(Cc1ncc[nH]1)Cc1ncc[nH]1)C(=O)O |
| InChI | InChI=1S/C14H22N6O2/c15-11(14(21)22)3-1-2-8-20(9-12-16-4-5-17-12)10-13-18-6-7-19-13/h4-7,11H,1-3,8-10,15H2,(H,16,17)(H,18,19)(H,21,22) |
| InChIKey | DQPLLPMXHIVATF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|