C26H42N6O6 — CID 71561780
(2R)-2-amino-6-[bis[[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]imidazol-2-yl]methyl]amino]hexanoic acid (PubChem CID 71561780) has the molecular formula C26H42N6O6 and a molecular weight of 534.66 g/mol. Its IUPAC name is (2R)-2-amino-6-[bis[[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]imidazol-2-yl]methyl]amino]hexanoic acid.
| Compound Name | (2R)-2-amino-6-[bis[[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]imidazol-2-yl]methyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 71561780 |
| Molecular Formula | C26H42N6O6 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | (2R)-2-amino-6-[bis[[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]imidazol-2-yl]methyl]amino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)Cn1ccnc1CN(CCCC[C@@H](N)C(=O)O)Cc1nccn1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H42N6O6/c1-25(2,3)37-22(33)17-31-13-10-28-20(31)15-30(12-8-7-9-19(27)24(35)36)16-21-29-11-14-32(21)18-23(34)38-26(4,5)6/h10-11,13-14,19H,7-9,12,15-18,27H2,1-6H3,(H,35,36)/t19-/m1/s1 |
| InChIKey | WPQJDODARUANOW-LJQANCHMSA-N |
| XLogP | 2.35 |
| TPSA | 154.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|