C35H24N4 — CID 70870233
2-[5-(3,5-dipyridin-3-ylphenyl)-2-pyridin-3-ylphenyl]-3H-indole (PubChem CID 70870233) has the molecular formula C35H24N4 and a molecular weight of 500.61 g/mol. Its IUPAC name is 2-[5-(3,5-dipyridin-3-ylphenyl)-2-pyridin-3-ylphenyl]-3H-indole.
| Compound Name | 2-[5-(3,5-dipyridin-3-ylphenyl)-2-pyridin-3-ylphenyl]-3H-indole |
|---|---|
| PubChem CID | 70870233 |
| Molecular Formula | C35H24N4 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 2-[5-(3,5-dipyridin-3-ylphenyl)-2-pyridin-3-ylphenyl]-3H-indole |
| SMILES | c1cncc(-c2cc(-c3cccnc3)cc(-c3ccc(-c4cccnc4)c(C4=Nc5ccccc5C4)c3)c2)c1 |
| InChI | InChI=1S/C35H24N4/c1-2-10-34-25(6-1)20-35(39-34)33-19-24(11-12-32(33)28-9-5-15-38-23-28)29-16-30(26-7-3-13-36-21-26)18-31(17-29)27-8-4-14-37-22-27/h1-19,21-23H,20H2 |
| InChIKey | ZECXGAUGIIRAFJ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |