C24H27F2N9O3 — CID 70870447
2-[4-[(5R)-5-[[[(Z)-2-aminoethenyl]-(methylideneamino)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(pyridin-3-ylmethyl)-4,6-dihydro-3H-1,2,5-triazepine-5-carboxamide (PubChem CID 70870447) has the molecular formula C24H27F2N9O3 and a molecular weight of 527.54 g/mol. Its IUPAC name is 2-[4-[(5R)-5-[[[(Z)-2-aminoethenyl]-(methylideneamino)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(pyridin-3-ylmethyl)-4,6-dihydro-3H-1,2,5-triazepine-5-carboxamide.
| Compound Name | 2-[4-[(5R)-5-[[[(Z)-2-aminoethenyl]-(methylideneamino)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(pyridin-3-ylmethyl)-4,6-dihydro-3H-1,2,5-triazepine-5-carboxamide |
|---|---|
| PubChem CID | 70870447 |
| Molecular Formula | C24H27F2N9O3 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 2-[4-[(5R)-5-[[[(Z)-2-aminoethenyl]-(methylideneamino)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(pyridin-3-ylmethyl)-4,6-dihydro-3H-1,2,5-triazepine-5-carboxamide |
| SMILES | C=NN(/C=C\N)C[C@H]1CN(c2cc(F)c(N3CCN(C(=O)NCc4cccnc4)CC=N3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H27F2N9O3/c1-28-33(7-4-27)15-19-16-34(24(37)38-19)18-11-20(25)22(21(26)12-18)35-10-9-32(8-6-31-35)23(36)30-14-17-3-2-5-29-13-17/h2-7,11-13,19H,1,8-10,14-16,27H2,(H,30,36)/b7-4-/t19-/m0/s1 |
| InChIKey | AZXQCQOXWPHQND-OCTSTCLRSA-N |
| XLogP | 2.05 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|