C21H25F2N9O4 — CID 70848461
1-[4-[(5R)-5-[[[(Z)-2-aminoethenyl]-(methylideneamino)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(1,2-oxazol-3-yl)-1,2,5-triazepane-5-carboxamide (PubChem CID 70848461) has the molecular formula C21H25F2N9O4 and a molecular weight of 505.49 g/mol. Its IUPAC name is 1-[4-[(5R)-5-[[[(Z)-2-aminoethenyl]-(methylideneamino)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(1,2-oxazol-3-yl)-1,2,5-triazepane-5-carboxamide.
| Compound Name | 1-[4-[(5R)-5-[[[(Z)-2-aminoethenyl]-(methylideneamino)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(1,2-oxazol-3-yl)-1,2,5-triazepane-5-carboxamide |
|---|---|
| PubChem CID | 70848461 |
| Molecular Formula | C21H25F2N9O4 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 1-[4-[(5R)-5-[[[(Z)-2-aminoethenyl]-(methylideneamino)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(1,2-oxazol-3-yl)-1,2,5-triazepane-5-carboxamide |
| SMILES | C=NN(/C=C\N)C[C@H]1CN(c2cc(F)c(N3CCN(C(=O)Nc4ccon4)CCN3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H25F2N9O4/c1-25-30(5-3-24)12-15-13-31(21(34)36-15)14-10-16(22)19(17(23)11-14)32-8-7-29(6-4-26-32)20(33)27-18-2-9-35-28-18/h2-3,5,9-11,15,26H,1,4,6-8,12-13,24H2,(H,27,28,33)/b5-3-/t15-/m0/s1 |
| InChIKey | HHDYSPDNNKSUHA-QTLSWZBMSA-N |
| XLogP | 1.48 |
| TPSA | 144.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|