C24H21N5O5 — CID 70871408
[3-[4-oxo-1-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]pyridazine-3-carbonyl]phenyl]carbamic acid (PubChem CID 70871408) has the molecular formula C24H21N5O5 and a molecular weight of 459.46 g/mol. Its IUPAC name is [3-[4-oxo-1-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]pyridazine-3-carbonyl]phenyl]carbamic acid.
| Compound Name | [3-[4-oxo-1-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]pyridazine-3-carbonyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 70871408 |
| Molecular Formula | C24H21N5O5 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | [3-[4-oxo-1-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]pyridazine-3-carbonyl]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1cccc(C(=O)c2nn(-c3cnn(CCOCc4ccccc4)c3)ccc2=O)c1 |
| InChI | InChI=1S/C24H21N5O5/c30-21-9-10-29(27-22(21)23(31)18-7-4-8-19(13-18)26-24(32)33)20-14-25-28(15-20)11-12-34-16-17-5-2-1-3-6-17/h1-10,13-15,26H,11-12,16H2,(H,32,33) |
| InChIKey | SQFNOILWYYULKQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|