C17H18INO2 — CID 70876869
3-(4-iodophenyl)-4-(methoxymethyl)-N,N-dimethylbenzamide (PubChem CID 70876869) has the molecular formula C17H18INO2 and a molecular weight of 395.24 g/mol. Its IUPAC name is 3-(4-iodophenyl)-4-(methoxymethyl)-N,N-dimethylbenzamide.
| Compound Name | 3-(4-iodophenyl)-4-(methoxymethyl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 70876869 |
| Molecular Formula | C17H18INO2 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 3-(4-iodophenyl)-4-(methoxymethyl)-N,N-dimethylbenzamide |
| SMILES | COCc1ccc(C(=O)N(C)C)cc1-c1ccc(I)cc1 |
| InChI | InChI=1S/C17H18INO2/c1-19(2)17(20)13-4-5-14(11-21-3)16(10-13)12-6-8-15(18)9-7-12/h4-10H,11H2,1-3H3 |
| InChIKey | FQDTWCOADBAWKA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|