C25H36O4Si2 — CID 70879724
1,7-bis(4-trimethylsilyloxyphenyl)heptane-3,5-dione (PubChem CID 70879724) has the molecular formula C25H36O4Si2 and a molecular weight of 456.73 g/mol. Its IUPAC name is 1,7-bis(4-trimethylsilyloxyphenyl)heptane-3,5-dione.
| Compound Name | 1,7-bis(4-trimethylsilyloxyphenyl)heptane-3,5-dione |
|---|---|
| PubChem CID | 70879724 |
| Molecular Formula | C25H36O4Si2 |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 1,7-bis(4-trimethylsilyloxyphenyl)heptane-3,5-dione |
| SMILES | C[Si](C)(C)Oc1ccc(CCC(=O)CC(=O)CCc2ccc(O[Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H36O4Si2/c1-30(2,3)28-24-15-9-20(10-16-24)7-13-22(26)19-23(27)14-8-21-11-17-25(18-12-21)29-31(4,5)6/h9-12,15-18H,7-8,13-14,19H2,1-6H3 |
| InChIKey | CGXADUFLBDNETP-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|