C26H38N6O — CID 70880999
(4-cyclohexylpiperidin-1-yl)-[1-(2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraen-8-yl)piperidin-3-yl]methanone (PubChem CID 70880999) has the molecular formula C26H38N6O and a molecular weight of 450.63 g/mol. Its IUPAC name is (4-cyclohexylpiperidin-1-yl)-[1-(2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraen-8-yl)piperidin-3-yl]methanone.
| Compound Name | (4-cyclohexylpiperidin-1-yl)-[1-(2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraen-8-yl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 70880999 |
| Molecular Formula | C26H38N6O |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | (4-cyclohexylpiperidin-1-yl)-[1-(2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraen-8-yl)piperidin-3-yl]methanone |
| SMILES | O=C(C1CCCN(c2c3c(nc4ccnn24)CNCC3)C1)N1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C26H38N6O/c33-26(30-15-10-20(11-16-30)19-5-2-1-3-6-19)21-7-4-14-31(18-21)25-22-8-12-27-17-23(22)29-24-9-13-28-32(24)25/h9,13,19-21,27H,1-8,10-12,14-18H2 |
| InChIKey | ZFLKWWYINLPWKL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 65.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |