C33H25N3 — CID 70882537
2-(6b,10a-dihydrofluoranthen-3-yl)-4,6-bis(4-methylphenyl)-1,3,5-triazine (PubChem CID 70882537) has the molecular formula C33H25N3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-(6b,10a-dihydrofluoranthen-3-yl)-4,6-bis(4-methylphenyl)-1,3,5-triazine.
| Compound Name | 2-(6b,10a-dihydrofluoranthen-3-yl)-4,6-bis(4-methylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 70882537 |
| Molecular Formula | C33H25N3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-(6b,10a-dihydrofluoranthen-3-yl)-4,6-bis(4-methylphenyl)-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3)nc(-c3ccc4c5c(cccc35)C3C=CC=CC43)n2)cc1 |
| InChI | InChI=1S/C33H25N3/c1-20-10-14-22(15-11-20)31-34-32(23-16-12-21(2)13-17-23)36-33(35-31)29-19-18-28-25-7-4-3-6-24(25)26-8-5-9-27(29)30(26)28/h3-19,24-25H,1-2H3 |
| InChIKey | FDQKDGMHIFXGKJ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |