C22H38O2 — CID 70888803
(2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl) 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 70888803) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is (2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl) 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl) 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 70888803 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | (2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl) 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC(C)(C)CC1(C(=O)OC2(C)CCC3CCCCC3C2)CC1(C)C |
| InChI | InChI=1S/C22H38O2/c1-19(2,3)14-22(15-20(22,4)5)18(23)24-21(6)12-11-16-9-7-8-10-17(16)13-21/h16-17H,7-15H2,1-6H3 |
| InChIKey | CJESAHZWYBUAMP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |