C22H34O4 — CID 89069335
(4-oxo-2-adamantyl)oxymethyl 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 89069335) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (4-oxo-2-adamantyl)oxymethyl 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (4-oxo-2-adamantyl)oxymethyl 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 89069335 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (4-oxo-2-adamantyl)oxymethyl 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC(C)(C)CC1(C(=O)OCOC2C3CC4CC(C3)C(=O)C2C4)CC1(C)C |
| InChI | InChI=1S/C22H34O4/c1-20(2,3)10-22(11-21(22,4)5)19(24)26-12-25-18-15-7-13-6-14(9-15)17(23)16(18)8-13/h13-16,18H,6-12H2,1-5H3 |
| InChIKey | BTWDUNHIXDDCJX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|