C15H16Cl2O4 — CID 70890943
methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate (PubChem CID 70890943) has the molecular formula C15H16Cl2O4 and a molecular weight of 331.20 g/mol. Its IUPAC name is methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate.
| Compound Name | methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate |
|---|---|
| PubChem CID | 70890943 |
| Molecular Formula | C15H16Cl2O4 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate |
| SMILES | COC(=O)C(C(C)=O)C(CC(C)=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H16Cl2O4/c1-8(18)7-11(13(9(2)19)15(20)21-3)10-5-4-6-12(16)14(10)17/h4-6,11,13H,7H2,1-3H3 |
| InChIKey | NJNFTRPWEQUVBC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|