methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate

C15H16Cl2O4 — CID 70890943

IUPACmethyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate
SMILESCOC(=O)C(C(C)=O)C(CC(C)=O)c1cccc(Cl)c1Cl
InChIInChI=1S/C15H16Cl2O4/c1-8(18)7-11(13(9(2)19)15(20)21-3)10-5-4-6-12(16)14(10)17/h4-6,11,13H,7H2,1-3H3
InChIKeyNJNFTRPWEQUVBC-UHFFFAOYSA-N
MW331.20 g/mol
LogP3.43
Rot. Bonds6

About methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate

methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate (PubChem CID 70890943) has the molecular formula C15H16Cl2O4 and a molecular weight of 331.20 g/mol. Its IUPAC name is methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate.

Molecular Properties

Compound Namemethyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate
PubChem CID70890943
Molecular FormulaC15H16Cl2O4
Molecular Weight331.20 g/mol
Exact Mass330.04
IUPAC Namemethyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate
SMILESCOC(=O)C(C(C)=O)C(CC(C)=O)c1cccc(Cl)c1Cl
InChIInChI=1S/C15H16Cl2O4/c1-8(18)7-11(13(9(2)19)15(20)21-3)10-5-4-6-12(16)14(10)17/h4-6,11,13H,7H2,1-3H3
InChIKeyNJNFTRPWEQUVBC-UHFFFAOYSA-N
XLogP3.43
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.20
LogP ≤ 53.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate?
The IUPAC name of methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate (CID 70890943) is methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate.
What is the SMILES notation for methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate?
The canonical SMILES for methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate is COC(=O)C(C(C)=O)C(CC(C)=O)c1cccc(Cl)c1Cl.
What is the InChIKey of methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate?
The InChIKey is NJNFTRPWEQUVBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2O4/c1-8(18)7-11(13(9(2)19)15(20)21-3)10-5-4-6-12(16)14(10)17/h4-6,11,13H,7H2,1-3H3.
What are the key properties of methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate?
methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate has a molecular weight of 331.20 g/mol, XLogP of 3.43, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetyl-3-(2,3-dichlorophenyl)-5-oxohexanoate is sourced from PubChem (CID 70890943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).