C18H15FN2O2 — CID 70895057
2-(4-fluorobenzoyl)-4,4a,9,9a-tetrahydro-3H-pyrido[3,4-b]indol-1-one (PubChem CID 70895057) has the molecular formula C18H15FN2O2 and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-(4-fluorobenzoyl)-4,4a,9,9a-tetrahydro-3H-pyrido[3,4-b]indol-1-one.
| Compound Name | 2-(4-fluorobenzoyl)-4,4a,9,9a-tetrahydro-3H-pyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 70895057 |
| Molecular Formula | C18H15FN2O2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-(4-fluorobenzoyl)-4,4a,9,9a-tetrahydro-3H-pyrido[3,4-b]indol-1-one |
| SMILES | O=C(c1ccc(F)cc1)N1CCC2c3ccccc3NC2C1=O |
| InChI | InChI=1S/C18H15FN2O2/c19-12-7-5-11(6-8-12)17(22)21-10-9-14-13-3-1-2-4-15(13)20-16(14)18(21)23/h1-8,14,16,20H,9-10H2 |
| InChIKey | RJWMZNOEVWFKPQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|